C23H23ClN4O5 — CID 42524149
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzoate (PubChem CID 42524149) has the molecular formula C23H23ClN4O5 and a molecular weight of 470.91 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzoate.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 42524149 |
| Molecular Formula | C23H23ClN4O5 |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl] 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzoate |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2ccc(C(=O)OCC(=O)Nc3cc(Cl)ccc3C#N)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C23H23ClN4O5/c1-14-7-15(2)12-27(11-14)20-6-4-16(8-21(20)28(31)32)23(30)33-13-22(29)26-19-9-18(24)5-3-17(19)10-25/h3-6,8-9,14-15H,7,11-13H2,1-2H3,(H,26,29)/t14-,15-/m1/s1 |
| InChIKey | DQLFXOBZBNXOCF-HUUCEWRRSA-N |
| XLogP | 4.40 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|