C20H20Cl2N4O5 — CID 41039402
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate (PubChem CID 41039402) has the molecular formula C20H20Cl2N4O5 and a molecular weight of 467.31 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 41039402 |
| Molecular Formula | C20H20Cl2N4O5 |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
| SMILES | C[C@@H]1CCCN(c2ccc(C(=O)OCC(=O)Nc3ncc(Cl)cc3Cl)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C20H20Cl2N4O5/c1-12-3-2-6-25(10-12)16-5-4-13(7-17(16)26(29)30)20(28)31-11-18(27)24-19-15(22)8-14(21)9-23-19/h4-5,7-9,12H,2-3,6,10-11H2,1H3,(H,23,24,27)/t12-/m1/s1 |
| InChIKey | NWQUWPMMIBUSKZ-GFCCVEGCSA-N |
| XLogP | 4.33 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|