C20H28N4O6 — CID 8854291
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate (PubChem CID 8854291) has the molecular formula C20H28N4O6 and a molecular weight of 420.47 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 8854291 |
| Molecular Formula | C20H28N4O6 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
| SMILES | C[C@H]1CCCN(c2ccc(C(=O)OCC(=O)NC(=O)NC(C)(C)C)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C20H28N4O6/c1-13-6-5-9-23(11-13)15-8-7-14(10-16(15)24(28)29)18(26)30-12-17(25)21-19(27)22-20(2,3)4/h7-8,10,13H,5-6,9,11-12H2,1-4H3,(H2,21,22,25,27)/t13-/m0/s1 |
| InChIKey | DSRAGKLIWCIHBL-ZDUSSCGKSA-N |
| XLogP | 2.61 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|