C21H21Cl2N3O5 — CID 4638659
[2-(2,5-dichloroanilino)-2-oxoethyl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 4638659) has the molecular formula C21H21Cl2N3O5 and a molecular weight of 466.32 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 4638659 |
| Molecular Formula | C21H21Cl2N3O5 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CCCN(c2ccc(C(=O)OCC(=O)Nc3cc(Cl)ccc3Cl)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H21Cl2N3O5/c1-13-3-2-8-25(11-13)18-7-4-14(9-19(18)26(29)30)21(28)31-12-20(27)24-17-10-15(22)5-6-16(17)23/h4-7,9-10,13H,2-3,8,11-12H2,1H3,(H,24,27) |
| InChIKey | CQGSIVSGCYAKGO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|