C18H19N5O7S — CID 23880779
[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 23880779) has the molecular formula C18H19N5O7S and a molecular weight of 449.45 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 23880779 |
| Molecular Formula | C18H19N5O7S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CCCN(c2ccc(C(=O)OCC(=O)Nc3ncc([N+](=O)[O-])s3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C18H19N5O7S/c1-11-3-2-6-21(9-11)13-5-4-12(7-14(13)22(26)27)17(25)30-10-15(24)20-18-19-8-16(31-18)23(28)29/h4-5,7-8,11H,2-3,6,9-10H2,1H3,(H,19,20,24) |
| InChIKey | BRDQVRQCASCYOL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 157.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|