C26H32N4O6 — CID 24518313
[2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 24518313) has the molecular formula C26H32N4O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 24518313 |
| Molecular Formula | C26H32N4O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CCCN(c2ccc(C(=O)OCC(=O)Nc3ccc(CN4CCOCC4)cc3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C26H32N4O6/c1-19-3-2-10-29(16-19)23-9-6-21(15-24(23)30(33)34)26(32)36-18-25(31)27-22-7-4-20(5-8-22)17-28-11-13-35-14-12-28/h4-9,15,19H,2-3,10-14,16-18H2,1H3,(H,27,31) |
| InChIKey | HESKPKKMLFXUFE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|