C23H25N3O7 — CID 5007783
[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 5007783) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 5007783 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CCN(c2ccc(C(=O)OCC(=O)Nc3ccc4c(c3)OCCO4)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H25N3O7/c1-15-6-8-25(9-7-15)18-4-2-16(12-19(18)26(29)30)23(28)33-14-22(27)24-17-3-5-20-21(13-17)32-11-10-31-20/h2-5,12-13,15H,6-11,14H2,1H3,(H,24,27) |
| InChIKey | RNKAZJUTFPMHQU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|