C24H27N3O7 — CID 42980896
[2-[1-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 42980896) has the molecular formula C24H27N3O7 and a molecular weight of 469.49 g/mol. Its IUPAC name is [2-[1-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [2-[1-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 42980896 |
| Molecular Formula | C24H27N3O7 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | [2-[1-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl] 4-(4-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CCN(c2ccc(C(=O)OCC(=O)NC(C)c3ccc4c(c3)OCO4)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H27N3O7/c1-15-7-9-26(10-8-15)19-5-3-18(11-20(19)27(30)31)24(29)32-13-23(28)25-16(2)17-4-6-21-22(12-17)34-14-33-21/h3-6,11-12,15-16H,7-10,13-14H2,1-2H3,(H,25,28) |
| InChIKey | XFILZUDYXXVFSB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|