C20H27N3O5 — CID 7376617
(2-oxo-2-piperidin-1-ylethyl) 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate (PubChem CID 7376617) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 7376617 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
| SMILES | C[C@H]1CCCN(c2ccc(C(=O)OCC(=O)N3CCCCC3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C20H27N3O5/c1-15-6-5-11-22(13-15)17-8-7-16(12-18(17)23(26)27)20(25)28-14-19(24)21-9-3-2-4-10-21/h7-8,12,15H,2-6,9-11,13-14H2,1H3/t15-/m0/s1 |
| InChIKey | BHJBHDKDIIOYPM-HNNXBMFYSA-N |
| XLogP | 3.00 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|