C22H29N3O7 — CID 42965454
methyl 1-[2-[4-(3-methylpiperidin-1-yl)-3-nitrobenzoyl]oxyacetyl]piperidine-4-carboxylate (PubChem CID 42965454) has the molecular formula C22H29N3O7 and a molecular weight of 447.49 g/mol. Its IUPAC name is methyl 1-[2-[4-(3-methylpiperidin-1-yl)-3-nitrobenzoyl]oxyacetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[4-(3-methylpiperidin-1-yl)-3-nitrobenzoyl]oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42965454 |
| Molecular Formula | C22H29N3O7 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | methyl 1-[2-[4-(3-methylpiperidin-1-yl)-3-nitrobenzoyl]oxyacetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)COC(=O)c2ccc(N3CCCC(C)C3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C22H29N3O7/c1-15-4-3-9-24(13-15)18-6-5-17(12-19(18)25(29)30)22(28)32-14-20(26)23-10-7-16(8-11-23)21(27)31-2/h5-6,12,15-16H,3-4,7-11,13-14H2,1-2H3 |
| InChIKey | ABSNMSMHKSWBFS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|