C21H29N3O5 — CID 7378943
[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 3-nitro-4-piperidin-1-ylbenzoate (PubChem CID 7378943) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is [2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 3-nitro-4-piperidin-1-ylbenzoate.
| Compound Name | [2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 3-nitro-4-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 7378943 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | [2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 3-nitro-4-piperidin-1-ylbenzoate |
| SMILES | C[C@H]1CCC[C@H](C)N1C(=O)COC(=O)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H29N3O5/c1-15-7-6-8-16(2)23(15)20(25)14-29-21(26)17-9-10-18(19(13-17)24(27)28)22-11-4-3-5-12-22/h9-10,13,15-16H,3-8,11-12,14H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | VHNMJUKZCKCXHZ-HOTGVXAUSA-N |
| XLogP | 3.53 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|