C16H19BrN2O5 — CID 7363353
[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 4-bromo-3-nitrobenzoate (PubChem CID 7363353) has the molecular formula C16H19BrN2O5 and a molecular weight of 399.24 g/mol. Its IUPAC name is [2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 4-bromo-3-nitrobenzoate.
| Compound Name | [2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 4-bromo-3-nitrobenzoate |
|---|---|
| PubChem CID | 7363353 |
| Molecular Formula | C16H19BrN2O5 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | [2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 4-bromo-3-nitrobenzoate |
| SMILES | C[C@@H]1CCC[C@@H](C)N1C(=O)COC(=O)c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H19BrN2O5/c1-10-4-3-5-11(2)18(10)15(20)9-24-16(21)12-6-7-13(17)14(8-12)19(22)23/h6-8,10-11H,3-5,9H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | UVFQDYNAUXLLPT-GHMZBOCLSA-N |
| XLogP | 3.30 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|