C15H17BrN2O5 — CID 7726132
[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-bromo-3-nitrobenzoate (PubChem CID 7726132) has the molecular formula C15H17BrN2O5 and a molecular weight of 385.21 g/mol. Its IUPAC name is [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-bromo-3-nitrobenzoate.
| Compound Name | [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-bromo-3-nitrobenzoate |
|---|---|
| PubChem CID | 7726132 |
| Molecular Formula | C15H17BrN2O5 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-bromo-3-nitrobenzoate |
| SMILES | C[C@@H]1CCCN(C(=O)COC(=O)c2ccc(Br)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C15H17BrN2O5/c1-10-3-2-6-17(8-10)14(19)9-23-15(20)11-4-5-12(16)13(7-11)18(21)22/h4-5,7,10H,2-3,6,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | WKBCNDMCNFGHJJ-SNVBAGLBSA-N |
| XLogP | 2.77 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|