C21H21ClN2O6 — CID 42971500
[2-(3-methylpiperidin-1-yl)-2-oxoethyl] 4-(4-chloro-2-nitrophenoxy)benzoate (PubChem CID 42971500) has the molecular formula C21H21ClN2O6 and a molecular weight of 432.86 g/mol. Its IUPAC name is [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 4-(4-chloro-2-nitrophenoxy)benzoate.
| Compound Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 4-(4-chloro-2-nitrophenoxy)benzoate |
|---|---|
| PubChem CID | 42971500 |
| Molecular Formula | C21H21ClN2O6 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 4-(4-chloro-2-nitrophenoxy)benzoate |
| SMILES | CC1CCCN(C(=O)COC(=O)c2ccc(Oc3ccc(Cl)cc3[N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C21H21ClN2O6/c1-14-3-2-10-23(12-14)20(25)13-29-21(26)15-4-7-17(8-5-15)30-19-9-6-16(22)11-18(19)24(27)28/h4-9,11,14H,2-3,10,12-13H2,1H3 |
| InChIKey | YCHACLSOBOKTBR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|