C26H35N3O5 — CID 23768505
[2-(1-adamantylamino)-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 23768505) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 23768505 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CC(C)CN(c2ccc(C(=O)OCC(=O)NC34CC5CC(CC(C5)C3)C4)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C26H35N3O5/c1-16-5-17(2)14-28(13-16)22-4-3-21(9-23(22)29(32)33)25(31)34-15-24(30)27-26-10-18-6-19(11-26)8-20(7-18)12-26/h3-4,9,16-20H,5-8,10-15H2,1-2H3,(H,27,30) |
| InChIKey | VISKCHWOLVCKNX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|