C24H28N2O7 — CID 25426194
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzoate (PubChem CID 25426194) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 25426194 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzoate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)c2ccc(N3C[C@@H](C)C[C@H](C)C3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C24H28N2O7/c1-15-9-16(2)13-25(12-15)20-7-5-17(10-21(20)26(29)30)24(28)33-14-22(27)19-11-18(31-3)6-8-23(19)32-4/h5-8,10-11,15-16H,9,12-14H2,1-4H3/t15-,16-/m0/s1 |
| InChIKey | OZFGKHCWNXIKNT-HOTGVXAUSA-N |
| XLogP | 4.13 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|