C23H26N2O7 — CID 23821711
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-(azepan-1-yl)-3-nitrobenzoate (PubChem CID 23821711) has the molecular formula C23H26N2O7 and a molecular weight of 442.47 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-(azepan-1-yl)-3-nitrobenzoate.
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-(azepan-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 23821711 |
| Molecular Formula | C23H26N2O7 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-(azepan-1-yl)-3-nitrobenzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(N3CCCCCC3)c([N+](=O)[O-])c2)c(OC)c1 |
| InChI | InChI=1S/C23H26N2O7/c1-30-17-8-9-18(22(14-17)31-2)21(26)15-32-23(27)16-7-10-19(20(13-16)25(28)29)24-11-5-3-4-6-12-24/h7-10,13-14H,3-6,11-12,15H2,1-2H3 |
| InChIKey | FJDAUHDEGWSKNQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|