C20H22N2O6 — CID 4812826
(2,6-dimethoxyphenyl) 3-nitro-4-piperidin-1-ylbenzoate (PubChem CID 4812826) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl) 3-nitro-4-piperidin-1-ylbenzoate.
| Compound Name | (2,6-dimethoxyphenyl) 3-nitro-4-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 4812826 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (2,6-dimethoxyphenyl) 3-nitro-4-piperidin-1-ylbenzoate |
| SMILES | COc1cccc(OC)c1OC(=O)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H22N2O6/c1-26-17-7-6-8-18(27-2)19(17)28-20(23)14-9-10-15(16(13-14)22(24)25)21-11-4-3-5-12-21/h6-10,13H,3-5,11-12H2,1-2H3 |
| InChIKey | GTPFGZRXTPOYPR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|