C18H17NO7S — CID 7489281
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-3-nitrobenzoate (PubChem CID 7489281) has the molecular formula C18H17NO7S and a molecular weight of 391.40 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-3-nitrobenzoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7489281 |
| Molecular Formula | C18H17NO7S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-3-nitrobenzoate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)c2ccc(SC)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C18H17NO7S/c1-24-12-5-6-16(25-2)13(9-12)15(20)10-26-18(21)11-4-7-17(27-3)14(8-11)19(22)23/h4-9H,10H2,1-3H3 |
| InChIKey | LRFVZHJITKEYOK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|