C18H28N4O3 — CID 119524785
N-(1-amino-2-methylpropan-2-yl)-4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzamide (PubChem CID 119524785) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzamide.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 119524785 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzamide |
| SMILES | CC1CC(C)CN(c2ccc(C(=O)NC(C)(C)CN)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C18H28N4O3/c1-12-7-13(2)10-21(9-12)15-6-5-14(8-16(15)22(24)25)17(23)20-18(3,4)11-19/h5-6,8,12-13H,7,9-11,19H2,1-4H3,(H,20,23) |
| InChIKey | NXXWMFYLUSHZTL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|