C20H31ClN4O3 — CID 119575637
N-(1-amino-2-cyclopropylpropan-2-yl)-4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzamide;hydrochloride (PubChem CID 119575637) has the molecular formula C20H31ClN4O3 and a molecular weight of 410.95 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzamide;hydrochloride.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119575637 |
| Molecular Formula | C20H31ClN4O3 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzamide;hydrochloride |
| SMILES | CC1CC(C)CN(c2ccc(C(=O)NC(C)(CN)C3CC3)cc2[N+](=O)[O-])C1.Cl |
| InChI | InChI=1S/C20H30N4O3.ClH/c1-13-8-14(2)11-23(10-13)17-7-4-15(9-18(17)24(26)27)19(25)22-20(3,12-21)16-5-6-16;/h4,7,9,13-14,16H,5-6,8,10-12,21H2,1-3H3,(H,22,25);1H |
| InChIKey | MCLMAUCKVBIAHZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|