About N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide
N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide (PubChem CID 81485410) has the molecular formula C15H22N2O
and a molecular weight of 246.35 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide |
| PubChem CID | 81485410 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(C)(CN)C2CC2)cc1C |
| InChI | InChI=1S/C15H22N2O/c1-10-4-5-12(8-11(10)2)14(18)17-15(3,9-16)13-6-7-13/h4-5,8,13H,6-7,9,16H2,1-3H3,(H,17,18) |
| InChIKey | GCXHBPWJGHRBQS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide?
The IUPAC name of N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide (CID 81485410) is N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide.
What is the SMILES notation for N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide?
The canonical SMILES for N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide is Cc1ccc(C(=O)NC(C)(CN)C2CC2)cc1C.
What is the InChIKey of N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide?
The InChIKey is GCXHBPWJGHRBQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O/c1-10-4-5-12(8-11(10)2)14(18)17-15(3,9-16)13-6-7-13/h4-5,8,13H,6-7,9,16H2,1-3H3,(H,17,18).
What are the key properties of N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide?
N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide has a molecular weight of 246.35 g/mol, XLogP of 2.16, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-2-cyclopropylpropan-2-yl)-3,4-dimethylbenzamide is sourced from PubChem (CID 81485410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).