C14H16F4N2O — CID 81486981
N-(1-amino-2-cyclopropylpropan-2-yl)-4-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 81486981) has the molecular formula C14H16F4N2O and a molecular weight of 304.29 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-4-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-4-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 81486981 |
| Molecular Formula | C14H16F4N2O |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-4-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | CC(CN)(NC(=O)c1ccc(F)c(C(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C14H16F4N2O/c1-13(7-19,9-3-4-9)20-12(21)8-2-5-11(15)10(6-8)14(16,17)18/h2,5-6,9H,3-4,7,19H2,1H3,(H,20,21) |
| InChIKey | BESWUSMTDDGIBW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |