C12H15ClF4N2O — CID 119524337
N-(1-amino-2-methylpropan-2-yl)-4-fluoro-3-(trifluoromethyl)benzamide;hydrochloride (PubChem CID 119524337) has the molecular formula C12H15ClF4N2O and a molecular weight of 314.71 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-4-fluoro-3-(trifluoromethyl)benzamide;hydrochloride.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-4-fluoro-3-(trifluoromethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119524337 |
| Molecular Formula | C12H15ClF4N2O |
| Molecular Weight | 314.71 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-4-fluoro-3-(trifluoromethyl)benzamide;hydrochloride |
| SMILES | CC(C)(CN)NC(=O)c1ccc(F)c(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C12H14F4N2O.ClH/c1-11(2,6-17)18-10(19)7-3-4-9(13)8(5-7)12(14,15)16;/h3-5H,6,17H2,1-2H3,(H,18,19);1H |
| InChIKey | BLFPWUAYWCFHOO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |