C9H7F4N3OS — CID 65216860
[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]thiourea (PubChem CID 65216860) has the molecular formula C9H7F4N3OS and a molecular weight of 281.23 g/mol. Its IUPAC name is [[4-fluoro-3-(trifluoromethyl)benzoyl]amino]thiourea.
| Compound Name | [[4-fluoro-3-(trifluoromethyl)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 65216860 |
| Molecular Formula | C9H7F4N3OS |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | [[4-fluoro-3-(trifluoromethyl)benzoyl]amino]thiourea |
| SMILES | NC(=S)NNC(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F4N3OS/c10-6-2-1-4(3-5(6)9(11,12)13)7(17)15-16-8(14)18/h1-3H,(H,15,17)(H3,14,16,18) |
| InChIKey | HWJHFUFZIJAGAX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|