C10H7F6N3OS — CID 2743161
[[3,5-bis(trifluoromethyl)benzoyl]amino]thiourea (PubChem CID 2743161) has the molecular formula C10H7F6N3OS and a molecular weight of 331.24 g/mol. Its IUPAC name is [[3,5-bis(trifluoromethyl)benzoyl]amino]thiourea.
| Compound Name | [[3,5-bis(trifluoromethyl)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 2743161 |
| Molecular Formula | C10H7F6N3OS |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | [[3,5-bis(trifluoromethyl)benzoyl]amino]thiourea |
| SMILES | NC(=S)NNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7F6N3OS/c11-9(12,13)5-1-4(7(20)18-19-8(17)21)2-6(3-5)10(14,15)16/h1-3H,(H,18,20)(H3,17,19,21) |
| InChIKey | RIMCVMYTXGEVLC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|