C17H18F6N2O2 — CID 3977040
N'-(2-cyclohexylacetyl)-3,5-bis(trifluoromethyl)benzohydrazide (PubChem CID 3977040) has the molecular formula C17H18F6N2O2 and a molecular weight of 396.33 g/mol. Its IUPAC name is N'-(2-cyclohexylacetyl)-3,5-bis(trifluoromethyl)benzohydrazide.
| Compound Name | N'-(2-cyclohexylacetyl)-3,5-bis(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 3977040 |
| Molecular Formula | C17H18F6N2O2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N'-(2-cyclohexylacetyl)-3,5-bis(trifluoromethyl)benzohydrazide |
| SMILES | O=C(CC1CCCCC1)NNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F6N2O2/c18-16(19,20)12-7-11(8-13(9-12)17(21,22)23)15(27)25-24-14(26)6-10-4-2-1-3-5-10/h7-10H,1-6H2,(H,24,26)(H,25,27) |
| InChIKey | JHINHIQBYMUBLZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|