C15H14F6N2O2 — CID 91363286
N-[2-(cyclobutylamino)-2-oxoethyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 91363286) has the molecular formula C15H14F6N2O2 and a molecular weight of 368.28 g/mol. Its IUPAC name is N-[2-(cyclobutylamino)-2-oxoethyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[2-(cyclobutylamino)-2-oxoethyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91363286 |
| Molecular Formula | C15H14F6N2O2 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-[2-(cyclobutylamino)-2-oxoethyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)NC1CCC1 |
| InChI | InChI=1S/C15H14F6N2O2/c16-14(17,18)9-4-8(5-10(6-9)15(19,20)21)13(25)22-7-12(24)23-11-2-1-3-11/h4-6,11H,1-3,7H2,(H,22,25)(H,23,24) |
| InChIKey | NAABGPCDMREUDL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |