C15H16F3N5O4 — CID 10157008
3-(diaminomethylideneamino)-N-[2-oxo-2-[[(3S)-5-oxooxolan-3-yl]amino]ethyl]-5-(trifluoromethyl)benzamide (PubChem CID 10157008) has the molecular formula C15H16F3N5O4 and a molecular weight of 387.32 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)-N-[2-oxo-2-[[(3S)-5-oxooxolan-3-yl]amino]ethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-(diaminomethylideneamino)-N-[2-oxo-2-[[(3S)-5-oxooxolan-3-yl]amino]ethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 10157008 |
| Molecular Formula | C15H16F3N5O4 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 3-(diaminomethylideneamino)-N-[2-oxo-2-[[(3S)-5-oxooxolan-3-yl]amino]ethyl]-5-(trifluoromethyl)benzamide |
| SMILES | NC(N)=Nc1cc(C(=O)NCC(=O)N[C@@H]2COC(=O)C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3N5O4/c16-15(17,18)8-1-7(2-9(3-8)23-14(19)20)13(26)21-5-11(24)22-10-4-12(25)27-6-10/h1-3,10H,4-6H2,(H,21,26)(H,22,24)(H4,19,20,23)/t10-/m0/s1 |
| InChIKey | OEZLFNDNNLRNME-JTQLQIEISA-N |
| XLogP | -0.23 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|