C21H20F3N5O7 — CID 20745194
3-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]-3-(5-hydroxy-1,3-benzodioxol-4-yl)propanoic acid (PubChem CID 20745194) has the molecular formula C21H20F3N5O7 and a molecular weight of 511.41 g/mol. Its IUPAC name is 3-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]-3-(5-hydroxy-1,3-benzodioxol-4-yl)propanoic acid.
| Compound Name | 3-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]-3-(5-hydroxy-1,3-benzodioxol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 20745194 |
| Molecular Formula | C21H20F3N5O7 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 3-[[2-[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]acetyl]amino]-3-(5-hydroxy-1,3-benzodioxol-4-yl)propanoic acid |
| SMILES | NC(N)=Nc1cc(C(=O)NCC(=O)NC(CC(=O)O)c2c(O)ccc3c2OCO3)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H20F3N5O7/c22-21(23,24)10-3-9(4-11(5-10)28-20(25)26)19(34)27-7-15(31)29-12(6-16(32)33)17-13(30)1-2-14-18(17)36-8-35-14/h1-5,12,30H,6-8H2,(H,27,34)(H,29,31)(H,32,33)(H4,25,26,28) |
| InChIKey | KALBDRNZBWGYIT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 198.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|