C21H20F3N5O5 — CID 87582713
(2,2,2-trifluoroacetyl) 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-phenylpropanoate (PubChem CID 87582713) has the molecular formula C21H20F3N5O5 and a molecular weight of 479.42 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-phenylpropanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 87582713 |
| Molecular Formula | C21H20F3N5O5 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-phenylpropanoate |
| SMILES | NC(N)=Nc1cccc(C(=O)NCC(=O)NC(CC(=O)OC(=O)C(F)(F)F)c2ccccc2)c1 |
| InChI | InChI=1S/C21H20F3N5O5/c22-21(23,24)19(33)34-17(31)10-15(12-5-2-1-3-6-12)29-16(30)11-27-18(32)13-7-4-8-14(9-13)28-20(25)26/h1-9,15H,10-11H2,(H,27,32)(H,29,30)(H4,25,26,28) |
| InChIKey | GUMSBSFTMFRSDZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 165.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|