C25H33N5O6 — CID 19357362
ethyl 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(3,5-diethoxyphenyl)propanoate (PubChem CID 19357362) has the molecular formula C25H33N5O6 and a molecular weight of 499.57 g/mol. Its IUPAC name is ethyl 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(3,5-diethoxyphenyl)propanoate.
| Compound Name | ethyl 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(3,5-diethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 19357362 |
| Molecular Formula | C25H33N5O6 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | ethyl 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(3,5-diethoxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)CNC(=O)c1cccc(N=C(N)N)c1)c1cc(OCC)cc(OCC)c1 |
| InChI | InChI=1S/C25H33N5O6/c1-4-34-19-11-17(12-20(13-19)35-5-2)21(14-23(32)36-6-3)30-22(31)15-28-24(33)16-8-7-9-18(10-16)29-25(26)27/h7-13,21H,4-6,14-15H2,1-3H3,(H,28,33)(H,30,31)(H4,26,27,29) |
| InChIKey | BWJCGRLIQKWKCS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|