C19H19Cl2N5O5 — CID 19357317
3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(3,5-dichloro-4-hydroxyphenyl)propanoic acid (PubChem CID 19357317) has the molecular formula C19H19Cl2N5O5 and a molecular weight of 468.30 g/mol. Its IUPAC name is 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(3,5-dichloro-4-hydroxyphenyl)propanoic acid.
| Compound Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(3,5-dichloro-4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 19357317 |
| Molecular Formula | C19H19Cl2N5O5 |
| Molecular Weight | 468.30 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(3,5-dichloro-4-hydroxyphenyl)propanoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)NCC(=O)NC(CC(=O)O)c2cc(Cl)c(O)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H19Cl2N5O5/c20-12-5-10(6-13(21)17(12)30)14(7-16(28)29)26-15(27)8-24-18(31)9-2-1-3-11(4-9)25-19(22)23/h1-6,14,30H,7-8H2,(H,24,31)(H,26,27)(H,28,29)(H4,22,23,25) |
| InChIKey | NQMAJXYVUBJMGV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 180.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|