C16H22N6O6 — CID 22608474
3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4-(2-hydroxyethylamino)-4-oxobutanoic acid (PubChem CID 22608474) has the molecular formula C16H22N6O6 and a molecular weight of 394.39 g/mol. Its IUPAC name is 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4-(2-hydroxyethylamino)-4-oxobutanoic acid.
| Compound Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4-(2-hydroxyethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22608474 |
| Molecular Formula | C16H22N6O6 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4-(2-hydroxyethylamino)-4-oxobutanoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)NCC(=O)NC(CC(=O)O)C(=O)NCCO)c1 |
| InChI | InChI=1S/C16H22N6O6/c17-16(18)21-10-3-1-2-9(6-10)14(27)20-8-12(24)22-11(7-13(25)26)15(28)19-4-5-23/h1-3,6,11,23H,4-5,7-8H2,(H,19,28)(H,20,27)(H,22,24)(H,25,26)(H4,17,18,21) |
| InChIKey | YTZNWZPTCFVGCW-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 209.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|