C18H25N5O4S — CID 157238699
3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(5-methylthiophen-2-yl)propanoic acid;molecular hydrogen (PubChem CID 157238699) has the molecular formula C18H25N5O4S and a molecular weight of 407.50 g/mol. Its IUPAC name is 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(5-methylthiophen-2-yl)propanoic acid;molecular hydrogen.
| Compound Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(5-methylthiophen-2-yl)propanoic acid;molecular hydrogen |
|---|---|
| PubChem CID | 157238699 |
| Molecular Formula | C18H25N5O4S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-3-(5-methylthiophen-2-yl)propanoic acid;molecular hydrogen |
| SMILES | Cc1ccc(C(CC(=O)O)NC(=O)CNC(=O)c2cccc(N=C(N)N)c2)s1.[H][H].[H][H] |
| InChI | InChI=1S/C18H21N5O4S.2H2/c1-10-5-6-14(28-10)13(8-16(25)26)23-15(24)9-21-17(27)11-3-2-4-12(7-11)22-18(19)20;;/h2-7,13H,8-9H2,1H3,(H,21,27)(H,23,24)(H,25,26)(H4,19,20,22);2*1H |
| InChIKey | AUYKDGHRJRRKBQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|