C19H22BrN5O4S — CID 20745487
ethyl 3-(4-bromothiophen-2-yl)-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]propanoate (PubChem CID 20745487) has the molecular formula C19H22BrN5O4S and a molecular weight of 496.39 g/mol. Its IUPAC name is ethyl 3-(4-bromothiophen-2-yl)-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]propanoate.
| Compound Name | ethyl 3-(4-bromothiophen-2-yl)-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 20745487 |
| Molecular Formula | C19H22BrN5O4S |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | ethyl 3-(4-bromothiophen-2-yl)-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)CNC(=O)c1cccc(N=C(N)N)c1)c1cc(Br)cs1 |
| InChI | InChI=1S/C19H22BrN5O4S/c1-2-29-17(27)8-14(15-7-12(20)10-30-15)25-16(26)9-23-18(28)11-4-3-5-13(6-11)24-19(21)22/h3-7,10,14H,2,8-9H2,1H3,(H,23,28)(H,25,26)(H4,21,22,24) |
| InChIKey | FPOUMERPSVNVIQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|