C14H19N5O5 — CID 56629115
(3S)-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4-hydroxybutanoic acid (PubChem CID 56629115) has the molecular formula C14H19N5O5 and a molecular weight of 337.34 g/mol. Its IUPAC name is (3S)-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (3S)-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 56629115 |
| Molecular Formula | C14H19N5O5 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (3S)-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4-hydroxybutanoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)NCC(=O)N[C@H](CO)CC(=O)O)c1 |
| InChI | InChI=1S/C14H19N5O5/c15-14(16)19-9-3-1-2-8(4-9)13(24)17-6-11(21)18-10(7-20)5-12(22)23/h1-4,10,20H,5-7H2,(H,17,24)(H,18,21)(H,22,23)(H4,15,16,19)/t10-/m0/s1 |
| InChIKey | FHIJWNMOKCMHNL-JTQLQIEISA-N |
| XLogP | -1.73 |
| TPSA | 180.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|