C17H21N5O4 — CID 54039912
ethyl (3S)-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]pent-4-ynoate (PubChem CID 54039912) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is ethyl (3S)-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]pent-4-ynoate.
| Compound Name | ethyl (3S)-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]pent-4-ynoate |
|---|---|
| PubChem CID | 54039912 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | ethyl (3S)-3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]pent-4-ynoate |
| SMILES | C#C[C@H](CC(=O)OCC)NC(=O)CNC(=O)c1cccc(N=C(N)N)c1 |
| InChI | InChI=1S/C17H21N5O4/c1-3-12(9-15(24)26-4-2)21-14(23)10-20-16(25)11-6-5-7-13(8-11)22-17(18)19/h1,5-8,12H,4,9-10H2,2H3,(H,20,25)(H,21,23)(H4,18,19,22)/t12-/m1/s1 |
| InChIKey | LLPBGQKNTOCUSK-GFCCVEGCSA-N |
| XLogP | -0.61 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|