C17H20N4O5 — CID 56616485
ethyl (3S)-3-[[2-[[3-(carbamoylamino)benzoyl]amino]acetyl]amino]pent-4-ynoate (PubChem CID 56616485) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is ethyl (3S)-3-[[2-[[3-(carbamoylamino)benzoyl]amino]acetyl]amino]pent-4-ynoate.
| Compound Name | ethyl (3S)-3-[[2-[[3-(carbamoylamino)benzoyl]amino]acetyl]amino]pent-4-ynoate |
|---|---|
| PubChem CID | 56616485 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | ethyl (3S)-3-[[2-[[3-(carbamoylamino)benzoyl]amino]acetyl]amino]pent-4-ynoate |
| SMILES | C#C[C@H](CC(=O)OCC)NC(=O)CNC(=O)c1cccc(NC(N)=O)c1 |
| InChI | InChI=1S/C17H20N4O5/c1-3-12(9-15(23)26-4-2)20-14(22)10-19-16(24)11-6-5-7-13(8-11)21-17(18)25/h1,5-8,12H,4,9-10H2,2H3,(H,19,24)(H,20,22)(H3,18,21,25)/t12-/m1/s1 |
| InChIKey | ZLOLVHRAXAPKES-GFCCVEGCSA-N |
| XLogP | -0.02 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|