C19H22N6O4 — CID 54365311
ethyl (3S)-3-[[2-[[3-[(N-isocyano-N'-methylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]pent-4-ynoate (PubChem CID 54365311) has the molecular formula C19H22N6O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is ethyl (3S)-3-[[2-[[3-[(N-isocyano-N'-methylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]pent-4-ynoate.
| Compound Name | ethyl (3S)-3-[[2-[[3-[(N-isocyano-N'-methylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]pent-4-ynoate |
|---|---|
| PubChem CID | 54365311 |
| Molecular Formula | C19H22N6O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | ethyl (3S)-3-[[2-[[3-[(N-isocyano-N'-methylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]pent-4-ynoate |
| SMILES | [C-]#[N+]N/C(=N\C)Nc1cccc(C(=O)NCC(=O)N[C@H](C#C)CC(=O)OCC)c1 |
| InChI | InChI=1S/C19H22N6O4/c1-5-14(11-17(27)29-6-2)23-16(26)12-22-18(28)13-8-7-9-15(10-13)24-19(20-3)25-21-4/h1,7-10,14H,6,11-12H2,2-3H3,(H,22,28)(H,23,26)(H2,20,24,25)/t14-/m1/s1 |
| InChIKey | UPJCWRIZLWXICH-CQSZACIVSA-N |
| XLogP | 0.31 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|