C28H29N7O4 — CID 20745449
ethyl 3-[[2-[[3-[[N-cyano-N'-(pyridin-2-ylmethyl)carbamimidoyl]amino]benzoyl]amino]acetyl]amino]-3-phenylpropanoate (PubChem CID 20745449) has the molecular formula C28H29N7O4 and a molecular weight of 527.59 g/mol. Its IUPAC name is ethyl 3-[[2-[[3-[[N-cyano-N'-(pyridin-2-ylmethyl)carbamimidoyl]amino]benzoyl]amino]acetyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl 3-[[2-[[3-[[N-cyano-N'-(pyridin-2-ylmethyl)carbamimidoyl]amino]benzoyl]amino]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 20745449 |
| Molecular Formula | C28H29N7O4 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | ethyl 3-[[2-[[3-[[N-cyano-N'-(pyridin-2-ylmethyl)carbamimidoyl]amino]benzoyl]amino]acetyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(NC(=O)CNC(=O)c1cccc(N/C(=N/Cc2ccccn2)NC#N)c1)c1ccccc1 |
| InChI | InChI=1S/C28H29N7O4/c1-2-39-26(37)16-24(20-9-4-3-5-10-20)35-25(36)18-31-27(38)21-11-8-13-22(15-21)34-28(33-19-29)32-17-23-12-6-7-14-30-23/h3-15,24H,2,16-18H2,1H3,(H,31,38)(H,35,36)(H2,32,33,34) |
| InChIKey | ZTQUMRKNQZTJEA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 157.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|