C27H30N6O4 — CID 20745446
ethyl 3-[[2-[[3-[(N'-benzylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoate (PubChem CID 20745446) has the molecular formula C27H30N6O4 and a molecular weight of 502.58 g/mol. Its IUPAC name is ethyl 3-[[2-[[3-[(N'-benzylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoate.
| Compound Name | ethyl 3-[[2-[[3-[(N'-benzylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 20745446 |
| Molecular Formula | C27H30N6O4 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | ethyl 3-[[2-[[3-[(N'-benzylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoate |
| SMILES | CCOC(=O)CC(NC(=O)CNC(=O)c1cccc(N/C(N)=N/Cc2ccccc2)c1)c1cccnc1 |
| InChI | InChI=1S/C27H30N6O4/c1-2-37-25(35)15-23(21-11-7-13-29-17-21)33-24(34)18-30-26(36)20-10-6-12-22(14-20)32-27(28)31-16-19-8-4-3-5-9-19/h3-14,17,23H,2,15-16,18H2,1H3,(H,30,36)(H,33,34)(H3,28,31,32) |
| InChIKey | UKAGQAVAAAVQKT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 147.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|