C22H25Cl2N5O4 — CID 20745476
ethyl 3-(3,5-dichlorophenyl)-3-[[2-[[3-[(N'-methylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]propanoate (PubChem CID 20745476) has the molecular formula C22H25Cl2N5O4 and a molecular weight of 494.38 g/mol. Its IUPAC name is ethyl 3-(3,5-dichlorophenyl)-3-[[2-[[3-[(N'-methylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]propanoate.
| Compound Name | ethyl 3-(3,5-dichlorophenyl)-3-[[2-[[3-[(N'-methylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 20745476 |
| Molecular Formula | C22H25Cl2N5O4 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | ethyl 3-(3,5-dichlorophenyl)-3-[[2-[[3-[(N'-methylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)CNC(=O)c1cccc(N/C(N)=N/C)c1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H25Cl2N5O4/c1-3-33-20(31)11-18(14-7-15(23)10-16(24)8-14)29-19(30)12-27-21(32)13-5-4-6-17(9-13)28-22(25)26-2/h4-10,18H,3,11-12H2,1-2H3,(H,27,32)(H,29,30)(H3,25,26,28) |
| InChIKey | VCSMDTCQIKMFGR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|