C14H19BCl2N2O4 — CID 20745136
N-[2-[[1-(3,5-dichlorophenyl)-3-ethoxy-3-oxopropyl]amino]-2-oxoethyl]-methylboronamidic acid (PubChem CID 20745136) has the molecular formula C14H19BCl2N2O4 and a molecular weight of 361.03 g/mol. Its IUPAC name is N-[2-[[1-(3,5-dichlorophenyl)-3-ethoxy-3-oxopropyl]amino]-2-oxoethyl]-methylboronamidic acid.
| Compound Name | N-[2-[[1-(3,5-dichlorophenyl)-3-ethoxy-3-oxopropyl]amino]-2-oxoethyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 20745136 |
| Molecular Formula | C14H19BCl2N2O4 |
| Molecular Weight | 361.03 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[2-[[1-(3,5-dichlorophenyl)-3-ethoxy-3-oxopropyl]amino]-2-oxoethyl]-methylboronamidic acid |
| SMILES | CCOC(=O)CC(NC(=O)CNB(C)O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H19BCl2N2O4/c1-3-23-14(21)7-12(19-13(20)8-18-15(2)22)9-4-10(16)6-11(17)5-9/h4-6,12,18,22H,3,7-8H2,1-2H3,(H,19,20) |
| InChIKey | PHRAGYIKGHFBGK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.03 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|