C14H19ClN2O4 — CID 167929050
ethyl 3-(2-aminooxypropanoylamino)-3-(3-chlorophenyl)propanoate (PubChem CID 167929050) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is ethyl 3-(2-aminooxypropanoylamino)-3-(3-chlorophenyl)propanoate.
| Compound Name | ethyl 3-(2-aminooxypropanoylamino)-3-(3-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 167929050 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | ethyl 3-(2-aminooxypropanoylamino)-3-(3-chlorophenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)C(C)ON)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2O4/c1-3-20-13(18)8-12(17-14(19)9(2)21-16)10-5-4-6-11(15)7-10/h4-7,9,12H,3,8,16H2,1-2H3,(H,17,19) |
| InChIKey | DAEMLVPBCQNBMS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|