C19H20Cl2N2O3 — CID 70018029
ethyl 3-(3-aminophenyl)-3-[[2-chloro-2-(4-chlorophenyl)acetyl]amino]propanoate (PubChem CID 70018029) has the molecular formula C19H20Cl2N2O3 and a molecular weight of 395.29 g/mol. Its IUPAC name is ethyl 3-(3-aminophenyl)-3-[[2-chloro-2-(4-chlorophenyl)acetyl]amino]propanoate.
| Compound Name | ethyl 3-(3-aminophenyl)-3-[[2-chloro-2-(4-chlorophenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 70018029 |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | ethyl 3-(3-aminophenyl)-3-[[2-chloro-2-(4-chlorophenyl)acetyl]amino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)C(Cl)c1ccc(Cl)cc1)c1cccc(N)c1 |
| InChI | InChI=1S/C19H20Cl2N2O3/c1-2-26-17(24)11-16(13-4-3-5-15(22)10-13)23-19(25)18(21)12-6-8-14(20)9-7-12/h3-10,16,18H,2,11,22H2,1H3,(H,23,25) |
| InChIKey | SLJXXRZDVWWFIZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|