C17H18N6O4 — CID 22608303
2-[[2-[[3-[(N-cyano-N'-methylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]pent-4-ynoic acid (PubChem CID 22608303) has the molecular formula C17H18N6O4 and a molecular weight of 370.37 g/mol. Its IUPAC name is 2-[[2-[[3-[(N-cyano-N'-methylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]pent-4-ynoic acid.
| Compound Name | 2-[[2-[[3-[(N-cyano-N'-methylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 22608303 |
| Molecular Formula | C17H18N6O4 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-[[2-[[3-[(N-cyano-N'-methylcarbamimidoyl)amino]benzoyl]amino]acetyl]amino]pent-4-ynoic acid |
| SMILES | C#CCC(NC(=O)CNC(=O)c1cccc(N/C(=N/C)NC#N)c1)C(=O)O |
| InChI | InChI=1S/C17H18N6O4/c1-3-5-13(16(26)27)23-14(24)9-20-15(25)11-6-4-7-12(8-11)22-17(19-2)21-10-18/h1,4,6-8,13H,5,9H2,2H3,(H,20,25)(H,23,24)(H,26,27)(H2,19,21,22) |
| InChIKey | WWVDJJWMWGCJDK-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 155.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|