C12H12N4O4 — CID 23023538
[3-[[2-(cyanomethylamino)-2-oxoethyl]carbamoyl]phenyl]carbamic acid (PubChem CID 23023538) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is [3-[[2-(cyanomethylamino)-2-oxoethyl]carbamoyl]phenyl]carbamic acid.
| Compound Name | [3-[[2-(cyanomethylamino)-2-oxoethyl]carbamoyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 23023538 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | [3-[[2-(cyanomethylamino)-2-oxoethyl]carbamoyl]phenyl]carbamic acid |
| SMILES | N#CCNC(=O)CNC(=O)c1cccc(NC(=O)O)c1 |
| InChI | InChI=1S/C12H12N4O4/c13-4-5-14-10(17)7-15-11(18)8-2-1-3-9(6-8)16-12(19)20/h1-3,6,16H,5,7H2,(H,14,17)(H,15,18)(H,19,20) |
| InChIKey | AZZVTZMJMLOYEO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|