C17H25N5O5 — CID 20745219
3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4-hydroxy-5-methylhexanoic acid (PubChem CID 20745219) has the molecular formula C17H25N5O5 and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4-hydroxy-5-methylhexanoic acid.
| Compound Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4-hydroxy-5-methylhexanoic acid |
|---|---|
| PubChem CID | 20745219 |
| Molecular Formula | C17H25N5O5 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4-hydroxy-5-methylhexanoic acid |
| SMILES | CC(C)C(O)C(CC(=O)O)NC(=O)CNC(=O)c1cccc(N=C(N)N)c1 |
| InChI | InChI=1S/C17H25N5O5/c1-9(2)15(26)12(7-14(24)25)22-13(23)8-20-16(27)10-4-3-5-11(6-10)21-17(18)19/h3-6,9,12,15,26H,7-8H2,1-2H3,(H,20,27)(H,22,23)(H,24,25)(H4,18,19,21) |
| InChIKey | YIFURXVEBXMBRU-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 180.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|