C14H16F3N5O4 — CID 70060619
2-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4,4,4-trifluorobutanoic acid (PubChem CID 70060619) has the molecular formula C14H16F3N5O4 and a molecular weight of 375.31 g/mol. Its IUPAC name is 2-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4,4,4-trifluorobutanoic acid.
| Compound Name | 2-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 70060619 |
| Molecular Formula | C14H16F3N5O4 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]-4,4,4-trifluorobutanoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)NCC(=O)NC(CC(F)(F)F)C(=O)O)c1 |
| InChI | InChI=1S/C14H16F3N5O4/c15-14(16,17)5-9(12(25)26)22-10(23)6-20-11(24)7-2-1-3-8(4-7)21-13(18)19/h1-4,9H,5-6H2,(H,20,24)(H,22,23)(H,25,26)(H4,18,19,21) |
| InChIKey | GGFYRLDJXXWSKN-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|